C23H41N4O8P — CID 161184904
1-[(2R,3R,4R,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;tritiooxymethane (PubChem CID 161184904) has the molecular formula C23H41N4O8P and a molecular weight of 535.59 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;tritiooxymethane.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;tritiooxymethane |
|---|---|
| PubChem CID | 161184904 |
| Molecular Formula | C23H41N4O8P |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;tritiooxymethane |
| SMILES | [2H]C[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OCCCO)[C@@H]1OP(OCC[N+]#[C-])N(C(C)C)C(C)C.[3H]OC |
| InChI | InChI=1S/C22H37N4O7P.CH4O/c1-14(2)26(15(3)4)34(31-12-9-23-7)33-18-17(6)32-21(19(18)30-11-8-10-27)25-13-16(5)20(28)24-22(25)29;1-2/h13-15,17-19,21,27H,8-12H2,1-6H3,(H,24,28,29);2H,1H3/t17-,18-,19-,21-,34?;/m1./s1/i6D;2T |
| InChIKey | USYOMGRBNIQTBH-CYPAEENESA-N |
| XLogP | 1.81 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|