C25H44N4O8P2 — CID 158698712
1-[(2R,3R,4S,5S)-5-[(1S)-1-dimethylphosphorylethyl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 158698712) has the molecular formula C25H44N4O8P2 and a molecular weight of 590.60 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-[(1S)-1-dimethylphosphorylethyl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-[(1S)-1-dimethylphosphorylethyl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158698712 |
| Molecular Formula | C25H44N4O8P2 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-[(1S)-1-dimethylphosphorylethyl]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCOP(O[C@H]1[C@@H](OCCOC)[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1[C@H](C)P(C)(C)=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44N4O8P2/c1-16(2)29(17(3)4)38(35-12-11-26-7)37-21-20(19(6)39(9,10)32)36-24(22(21)34-14-13-33-8)28-15-18(5)23(30)27-25(28)31/h15-17,19-22,24H,11-14H2,1-6,8-10H3,(H,27,30,31)/t19-,20+,21+,22+,24+,38?/m0/s1 |
| InChIKey | JLQOWAQNONBVSP-JUMCFNRPSA-N |
| XLogP | 3.45 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|