C28H50N4O10P2 — CID 178052341
3-[[(2R,3R,4R,5R)-2-(3-diethoxyphosphorylpropyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 178052341) has the molecular formula C28H50N4O10P2 and a molecular weight of 664.67 g/mol. Its IUPAC name is 3-[[(2R,3R,4R,5R)-2-(3-diethoxyphosphorylpropyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3R,4R,5R)-2-(3-diethoxyphosphorylpropyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 178052341 |
| Molecular Formula | C28H50N4O10P2 |
| Molecular Weight | 664.67 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 3-[[(2R,3R,4R,5R)-2-(3-diethoxyphosphorylpropyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CCOP(=O)(CCC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OCCOC)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C28H50N4O10P2/c1-9-39-44(35,40-10-2)18-11-13-23-24(42-43(38-15-12-14-29)32(20(3)4)21(5)6)25(37-17-16-36-8)27(41-23)31-19-22(7)26(33)30-28(31)34/h19-21,23-25,27H,9-13,15-18H2,1-8H3,(H,30,33,34)/t23-,24-,25-,27-,43?/m1/s1 |
| InChIKey | UHOKGWSOVGERMA-JQMCJRSTSA-N |
| XLogP | 4.48 |
| TPSA | 163.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|