C22H37N5O9P2 — CID 177266845
1-[(2R,5S)-5-[(E)-1-dimethoxyphosphorylethylideneamino]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 177266845) has the molecular formula C22H37N5O9P2 and a molecular weight of 577.51 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[(E)-1-dimethoxyphosphorylethylideneamino]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[(E)-1-dimethoxyphosphorylethylideneamino]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177266845 |
| Molecular Formula | C22H37N5O9P2 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 1-[(2R,5S)-5-[(E)-1-dimethoxyphosphorylethylideneamino]-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCOP(OC1C(OC)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1/N=C(\C)P(=O)(OC)OC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H37N5O9P2/c1-14(2)27(15(3)4)37(34-13-11-23-6)36-18-19(31-7)21(26-12-10-17(28)25-22(26)29)35-20(18)24-16(5)38(30,32-8)33-9/h10,12,14-15,18-21H,11,13H2,1-5,7-9H3,(H,25,28,29)/b24-16+/t18?,19?,20-,21+,37?/m0/s1 |
| InChIKey | HASYPWGUVXIHPN-XQTWJQACSA-N |
| XLogP | 2.98 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|