C20H33FN4O9P2 — CID 142299843
3-[[(2R,5R)-2-(dimethoxyphosphorylmethoxy)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 142299843) has the molecular formula C20H33FN4O9P2 and a molecular weight of 554.45 g/mol. Its IUPAC name is 3-[[(2R,5R)-2-(dimethoxyphosphorylmethoxy)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,5R)-2-(dimethoxyphosphorylmethoxy)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 142299843 |
| Molecular Formula | C20H33FN4O9P2 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 3-[[(2R,5R)-2-(dimethoxyphosphorylmethoxy)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(=O)(CO[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(F)C1OP(OCCC#N)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C20H33FN4O9P2/c1-13(2)25(14(3)4)35(32-11-7-9-22)34-17-16(21)18(24-10-8-15(26)23-20(24)27)33-19(17)31-12-36(28,29-5)30-6/h8,10,13-14,16-19H,7,11-12H2,1-6H3,(H,23,26,27)/t16?,17?,18-,19+,35?/m1/s1 |
| InChIKey | IWTDWIAEWRMAIS-XCUSNESLSA-N |
| XLogP | 2.85 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|