C24H39N4O9PS — CID 178052013
2-methylpropyl (E)-2-[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]ethenesulfonate (PubChem CID 178052013) has the molecular formula C24H39N4O9PS and a molecular weight of 590.64 g/mol. Its IUPAC name is 2-methylpropyl (E)-2-[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]ethenesulfonate.
| Compound Name | 2-methylpropyl (E)-2-[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]ethenesulfonate |
|---|---|
| PubChem CID | 178052013 |
| Molecular Formula | C24H39N4O9PS |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-methylpropyl (E)-2-[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]ethenesulfonate |
| SMILES | COC1C(OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](/C=C/S(=O)(=O)OCC(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C24H39N4O9PS/c1-16(2)15-35-39(31,32)14-10-19-21(37-38(34-13-8-11-25)28(17(3)4)18(5)6)22(33-7)23(36-19)27-12-9-20(29)26-24(27)30/h9-10,12,14,16-19,21-23H,8,13,15H2,1-7H3,(H,26,29,30)/b14-10+/t19-,21?,22?,23-,38?/m1/s1 |
| InChIKey | YQSNZJZHWCSBRE-YBYBQPFISA-N |
| XLogP | 2.63 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|