C24H38N4O9P2 — CID 174012598
3-[[(1R,4R,5R)-6-[(E)-2-dimethoxyphosphorylethenyl]-8-(2,4-dioxopyrimidin-1-yl)-2,7-dioxabicyclo[3.3.1]nonan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 174012598) has the molecular formula C24H38N4O9P2 and a molecular weight of 588.53 g/mol. Its IUPAC name is 3-[[(1R,4R,5R)-6-[(E)-2-dimethoxyphosphorylethenyl]-8-(2,4-dioxopyrimidin-1-yl)-2,7-dioxabicyclo[3.3.1]nonan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(1R,4R,5R)-6-[(E)-2-dimethoxyphosphorylethenyl]-8-(2,4-dioxopyrimidin-1-yl)-2,7-dioxabicyclo[3.3.1]nonan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 174012598 |
| Molecular Formula | C24H38N4O9P2 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 3-[[(1R,4R,5R)-6-[(E)-2-dimethoxyphosphorylethenyl]-8-(2,4-dioxopyrimidin-1-yl)-2,7-dioxabicyclo[3.3.1]nonan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(=O)(/C=C/C1OC(n2ccc(=O)[nH]c2=O)[C@H]2C[C@H]1[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)CO2)OC |
| InChI | InChI=1S/C24H38N4O9P2/c1-16(2)28(17(3)4)38(35-12-7-10-25)37-21-15-34-20-14-18(21)19(9-13-39(31,32-5)33-6)36-23(20)27-11-8-22(29)26-24(27)30/h8-9,11,13,16-21,23H,7,12,14-15H2,1-6H3,(H,26,29,30)/b13-9+/t18-,19?,20-,21+,23?,38?/m1/s1 |
| InChIKey | GHLQVYOTOWRZSB-ZRNXCYJLSA-N |
| XLogP | 3.50 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|