C22H36N4O7P2 — CID 139306977
3-[[2-[(E)-2-dimethoxyphosphanylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 139306977) has the molecular formula C22H36N4O7P2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 3-[[2-[(E)-2-dimethoxyphosphanylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[2-[(E)-2-dimethoxyphosphanylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 139306977 |
| Molecular Formula | C22H36N4O7P2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3-[[2-[(E)-2-dimethoxyphosphanylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(/C=C/C1OCC(n2ccc(=O)[nH]c2=O)CC1OP(OCCC#N)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C22H36N4O7P2/c1-16(2)26(17(3)4)35(32-12-7-10-23)33-20-14-18(25-11-8-21(27)24-22(25)28)15-31-19(20)9-13-34(29-5)30-6/h8-9,11,13,16-20H,7,12,14-15H2,1-6H3,(H,24,27,28)/b13-9+ |
| InChIKey | RKFXVTPGBPJBRY-UKTHLTGXSA-N |
| XLogP | 3.65 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|