C21H34N4O8P2 — CID 138530271
3-[[(2R,3S,5R)-2-[(E)-2-dimethoxyphosphorylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 138530271) has the molecular formula C21H34N4O8P2 and a molecular weight of 532.47 g/mol. Its IUPAC name is 3-[[(2R,3S,5R)-2-[(E)-2-dimethoxyphosphorylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3S,5R)-2-[(E)-2-dimethoxyphosphorylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 138530271 |
| Molecular Formula | C21H34N4O8P2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-[[(2R,3S,5R)-2-[(E)-2-dimethoxyphosphorylethenyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(=O)(/C=C/[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C21H34N4O8P2/c1-15(2)25(16(3)4)34(31-12-7-10-22)33-18-14-20(24-11-8-19(26)23-21(24)27)32-17(18)9-13-35(28,29-5)30-6/h8-9,11,13,15-18,20H,7,12,14H2,1-6H3,(H,23,26,27)/b13-9+/t17-,18+,20-,34?/m1/s1 |
| InChIKey | NCICIRWWJNQVNP-HWNDUTJRSA-N |
| XLogP | 3.48 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|