C25H42N4O8P2 — CID 175940654
3-[[(1R,2S,3R,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 175940654) has the molecular formula C25H42N4O8P2 and a molecular weight of 588.58 g/mol. Its IUPAC name is 3-[[(1R,2S,3R,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(1R,2S,3R,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 175940654 |
| Molecular Formula | C25H42N4O8P2 |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 3-[[(1R,2S,3R,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3-(2,4-dioxopyrimidin-1-yl)-2-methoxycyclopentyl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CCOP(=O)(/C=C/[C@H]1C[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C25H42N4O8P2/c1-8-35-39(32,36-9-2)16-12-20-17-21(28-14-11-22(30)27-25(28)31)24(33-7)23(20)37-38(34-15-10-13-26)29(18(3)4)19(5)6/h11-12,14,16,18-21,23-24H,8-10,15,17H2,1-7H3,(H,27,30,31)/b16-12+/t20-,21+,23+,24-,38?/m0/s1 |
| InChIKey | JZXMOYKYUYVMSS-FSOIWCFCSA-N |
| XLogP | 4.55 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|