C20H31N4O6P — CID 58338767
3-[[(1R,3R,4S,7R)-1-(1-deuterioethyl)-3-(2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 58338767) has the molecular formula C20H31N4O6P and a molecular weight of 455.47 g/mol. Its IUPAC name is 3-[[(1R,3R,4S,7R)-1-(1-deuterioethyl)-3-(2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(1R,3R,4S,7R)-1-(1-deuterioethyl)-3-(2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 58338767 |
| Molecular Formula | C20H31N4O6P |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[[(1R,3R,4S,7R)-1-(1-deuterioethyl)-3-(2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | [2H]C(C)[C@]12CO[C@H]([C@H](n3ccc(=O)[nH]c3=O)O1)[C@H]2OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H31N4O6P/c1-6-20-12-27-16(18(29-20)23-10-8-15(25)22-19(23)26)17(20)30-31(28-11-7-9-21)24(13(2)3)14(4)5/h8,10,13-14,16-18H,6-7,11-12H2,1-5H3,(H,22,25,26)/t16-,17+,18+,20+,31?/m0/s1/i6D/t6?,16-,17+,18+,20+,31? |
| InChIKey | HFHARDDEHIWVHQ-JJOSEDTDSA-N |
| XLogP | 2.27 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|