C22H31N4O6P — CID 146895071
1-[(1S,3R,7R)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 146895071) has the molecular formula C22H31N4O6P and a molecular weight of 478.49 g/mol. Its IUPAC name is 1-[(1S,3R,7R)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,7R)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146895071 |
| Molecular Formula | C22H31N4O6P |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 1-[(1S,3R,7R)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCOP(O[C@@H]1C2OC[C@]1(CC)O[C@H]2n1cc(C#C)c(=O)[nH]c1=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H31N4O6P/c1-8-16-12-25(21(28)24-19(16)27)20-17-18(22(9-2,31-20)13-29-17)32-33(30-11-10-23-7)26(14(3)4)15(5)6/h1,12,14-15,17-18,20H,9-11,13H2,2-6H3,(H,24,27,28)/t17?,18-,20-,22+,33?/m1/s1 |
| InChIKey | TWMAPAONDFVKLR-RQTXRFAESA-N |
| XLogP | 2.26 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|