C20H32FN4O5P — CID 159009901
1-[(3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-fluoro-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 159009901) has the molecular formula C20H32FN4O5P and a molecular weight of 458.47 g/mol. Its IUPAC name is 1-[(3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-fluoro-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-fluoro-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159009901 |
| Molecular Formula | C20H32FN4O5P |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[(3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-fluoro-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CCOP(O[C@H]1[C@@H](F)C(n2ccc(=O)[nH]c2=O)O[C@]1(C)CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32FN4O5P/c1-8-20(6)17(16(21)18(29-20)24-11-9-15(26)23-19(24)27)30-31(28-12-10-22-7)25(13(2)3)14(4)5/h9,11,13-14,16-18H,8,10,12H2,1-6H3,(H,23,26,27)/t16-,17+,18?,20-,31?/m1/s1 |
| InChIKey | JSIVCCBRRRUWRO-MAIYFMIVSA-N |
| XLogP | 3.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|