C25H44FN4O6PS2 — CID 129062337
2-[4-[[2-(deuteriomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxybutyldisulfanyl]-N,N,2-trimethylpropanamide (PubChem CID 129062337) has the molecular formula C25H44FN4O6PS2 and a molecular weight of 611.76 g/mol. Its IUPAC name is 2-[4-[[2-(deuteriomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxybutyldisulfanyl]-N,N,2-trimethylpropanamide.
| Compound Name | 2-[4-[[2-(deuteriomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxybutyldisulfanyl]-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 129062337 |
| Molecular Formula | C25H44FN4O6PS2 |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | 2-[4-[[2-(deuteriomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxybutyldisulfanyl]-N,N,2-trimethylpropanamide |
| SMILES | [2H]CC1OC(n2ccc(=O)[nH]c2=O)C(F)C1OP(OCCCCSSC(C)(C)C(=O)N(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44FN4O6PS2/c1-16(2)30(17(3)4)37(34-14-10-11-15-38-39-25(6,7)23(32)28(8)9)36-21-18(5)35-22(20(21)26)29-13-12-19(31)27-24(29)33/h12-13,16-18,20-22H,10-11,14-15H2,1-9H3,(H,27,31,33)/i5D |
| InChIKey | DHYLXASDIQCZKY-UICOGKGYSA-N |
| XLogP | 4.57 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|