C26H45FN3O7PS — CID 58534095
S-[2-[2-[[(2R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-fluoro-5-methyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethyl] 2,2-dimethylpropanethioate (PubChem CID 58534095) has the molecular formula C26H45FN3O7PS and a molecular weight of 593.70 g/mol. Its IUPAC name is S-[2-[2-[[(2R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-fluoro-5-methyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-[[(2R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-fluoro-5-methyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 58534095 |
| Molecular Formula | C26H45FN3O7PS |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | S-[2-[2-[[(2R,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-fluoro-5-methyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethyl] 2,2-dimethylpropanethioate |
| SMILES | CC[C@H]1O[C@](C)(n2ccc(=O)[nH]c2=O)[C@@H](F)C1OP(OCCOCCSC(=O)C(C)(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C26H45FN3O7PS/c1-10-19-21(22(27)26(9,36-19)29-12-11-20(31)28-24(29)33)37-38(30(17(2)3)18(4)5)35-14-13-34-15-16-39-23(32)25(6,7)8/h11-12,17-19,21-22H,10,13-16H2,1-9H3,(H,28,31,33)/t19-,21?,22+,26+,38?/m1/s1 |
| InChIKey | GVOUWJKVYHVZMN-HZFIODTRSA-N |
| XLogP | 4.43 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|