C24H38FN2O10PS2 — CID 144828766
S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 144828766) has the molecular formula C24H38FN2O10PS2 and a molecular weight of 628.68 g/mol. Its IUPAC name is S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 144828766 |
| Molecular Formula | C24H38FN2O10PS2 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@]1(F)C[C@@](C)(O)[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C24H38FN2O10PS2/c1-21(2,3)18(29)39-12-10-34-38(33,35-11-13-40-19(30)22(4,5)6)36-15-24(25)14-23(7,32)17(37-24)27-9-8-16(28)26-20(27)31/h8-9,17,32H,10-15H2,1-7H3,(H,26,28,31)/t17-,23-,24+/m1/s1 |
| InChIKey | NRDBXZXVBGPYNT-VEYWIMSWSA-N |
| XLogP | 3.64 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|