C28H46FN2O9PS2 — CID 123301172
S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate (PubChem CID 123301172) has the molecular formula C28H46FN2O9PS2 and a molecular weight of 668.79 g/mol. Its IUPAC name is S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123301172 |
| Molecular Formula | C28H46FN2O9PS2 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-methyloxolan-2-yl]methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate |
| SMILES | CC1CC(F)(COP(=O)(OCCCCSC(=O)C(C)(C)C)OCCCCSC(=O)C(C)(C)C)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C28H46FN2O9PS2/c1-20-18-28(29,40-22(20)31-13-12-21(32)30-25(31)35)19-39-41(36,37-14-8-10-16-42-23(33)26(2,3)4)38-15-9-11-17-43-24(34)27(5,6)7/h12-13,20,22H,8-11,14-19H2,1-7H3,(H,30,32,35) |
| InChIKey | XSKSDRDYDXOKHR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|