C21H32FN2O15P — CID 144828889
[[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 144828889) has the molecular formula C21H32FN2O15P and a molecular weight of 602.46 g/mol. Its IUPAC name is [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 144828889 |
| Molecular Formula | C21H32FN2O15P |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | [[(2S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOP(=O)(OCOC(=O)OCCOC)OC[C@]1(CF)C[C@H](C)[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C21H32FN2O15P/c1-15-10-21(11-22,39-17(15)24-5-4-16(25)23-18(24)26)12-36-40(29,37-13-34-19(27)32-8-6-30-2)38-14-35-20(28)33-9-7-31-3/h4-5,15,17H,6-14H2,1-3H3,(H,23,25,26)/t15-,17+,21+/m0/s1 |
| InChIKey | YWMBISNPQMKDML-LUQKVYGDSA-N |
| XLogP | 1.47 |
| TPSA | 198.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|