C23H28FN2O11P — CID 123883629
[[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-phenylmethoxyphosphoryl]oxymethyl oxetan-3-yl carbonate (PubChem CID 123883629) has the molecular formula C23H28FN2O11P and a molecular weight of 558.45 g/mol. Its IUPAC name is [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-phenylmethoxyphosphoryl]oxymethyl oxetan-3-yl carbonate.
| Compound Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-phenylmethoxyphosphoryl]oxymethyl oxetan-3-yl carbonate |
|---|---|
| PubChem CID | 123883629 |
| Molecular Formula | C23H28FN2O11P |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-4-methyloxolan-2-yl]methoxy-phenylmethoxyphosphoryl]oxymethyl oxetan-3-yl carbonate |
| SMILES | CC1CC(CF)(COP(=O)(OCOC(=O)OC2COC2)OCc2ccccc2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H28FN2O11P/c1-16-9-23(13-24,37-20(16)26-8-7-19(27)25-21(26)28)14-34-38(30,33-10-17-5-3-2-4-6-17)35-15-32-22(29)36-18-11-31-12-18/h2-8,16,18,20H,9-15H2,1H3,(H,25,27,28) |
| InChIKey | DDSWIPWCTPUHFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|