C21H32FN2O16P — CID 123161775
[[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 123161775) has the molecular formula C21H32FN2O16P and a molecular weight of 618.46 g/mol. Its IUPAC name is [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 123161775 |
| Molecular Formula | C21H32FN2O16P |
| Molecular Weight | 618.46 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | [[5-(2,4-dioxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(2-methoxyethoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOP(=O)(OCOC(=O)OCCOC)OCC1(CF)OC(n2ccc(=O)[nH]c2=O)C(C)C1O |
| InChI | InChI=1S/C21H32FN2O16P/c1-14-16(26)21(10-22,40-17(14)24-5-4-15(25)23-18(24)27)11-37-41(30,38-12-35-19(28)33-8-6-31-2)39-13-36-20(29)34-9-7-32-3/h4-5,14,16-17,26H,6-13H2,1-3H3,(H,23,25,27) |
| InChIKey | DJMILGUXUSDYCN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 218.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.46 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|