About ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate
ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate (PubChem CID 144766967) has the molecular formula C14H21O8P
and a molecular weight of 348.29 g/mol. Its IUPAC name is ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate.
Molecular Properties
| Compound Name | ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate |
| PubChem CID | 144766967 |
| Molecular Formula | C14H21O8P |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate |
| SMILES | CC.O=C(OCOP(=O)(O)OCc1ccccc1)OC1COC1 |
| InChI | InChI=1S/C12H15O8P.C2H6/c13-12(20-11-7-16-8-11)17-9-19-21(14,15)18-6-10-4-2-1-3-5-10;1-2/h1-5,11H,6-9H2,(H,14,15);1-2H3 |
| InChIKey | DRTHPCVLWKYTDO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate?
The IUPAC name of ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate (CID 144766967) is ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate.
What is the SMILES notation for ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate?
The canonical SMILES for ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate is CC.O=C(OCOP(=O)(O)OCc1ccccc1)OC1COC1.
What is the InChIKey of ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate?
The InChIKey is DRTHPCVLWKYTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15O8P.C2H6/c13-12(20-11-7-16-8-11)17-9-19-21(14,15)18-6-10-4-2-1-3-5-10;1-2/h1-5,11H,6-9H2,(H,14,15);1-2H3.
What are the key properties of ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate?
ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate has a molecular weight of 348.29 g/mol, XLogP of 2.86, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[hydroxy(phenylmethoxy)phosphoryl]oxymethyl oxetan-3-yl carbonate is sourced from PubChem (CID 144766967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).