C24H38FN2O11PS2 — CID 118016803
S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 118016803) has the molecular formula C24H38FN2O11PS2 and a molecular weight of 644.68 g/mol. Its IUPAC name is S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118016803 |
| Molecular Formula | C24H38FN2O11PS2 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | S-[2-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@@]1(F)OC(n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C24H38FN2O11PS2/c1-21(2,3)18(30)40-12-10-35-39(34,36-11-13-41-19(31)22(4,5)6)37-14-24(25)16(29)23(7,33)17(38-24)27-9-8-15(28)26-20(27)32/h8-9,16-17,29,33H,10-14H2,1-7H3,(H,26,28,32)/t16-,17?,23+,24+/m0/s1 |
| InChIKey | IOTGCSXJMDNDDI-LOBYNPTRSA-N |
| XLogP | 2.61 |
| TPSA | 183.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|