C21H32ClFN3O8PS3 — CID 123216686
propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-1,3-oxathiolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 123216686) has the molecular formula C21H32ClFN3O8PS3 and a molecular weight of 636.13 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-1,3-oxathiolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-1,3-oxathiolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 123216686 |
| Molecular Formula | C21H32ClFN3O8PS3 |
| Molecular Weight | 636.13 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-1,3-oxathiolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=S)(OCCSC(=O)C(C)(C)C)OCC1OC(n2ccc(=O)[nH]c2=O)C(F)(Cl)S1 |
| InChI | InChI=1S/C21H32ClFN3O8PS3/c1-12(2)33-16(28)13(3)25-35(36,31-9-10-37-18(29)20(4,5)6)32-11-15-34-17(21(22,23)38-15)26-8-7-14(27)24-19(26)30/h7-8,12-13,15,17H,9-11H2,1-6H3,(H,25,36)(H,24,27,30) |
| InChIKey | FVJQURULVORPSH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|