C22H34Cl2N3O9PS2 — CID 118126724
propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 118126724) has the molecular formula C22H34Cl2N3O9PS2 and a molecular weight of 650.54 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118126724 |
| Molecular Formula | C22H34Cl2N3O9PS2 |
| Molecular Weight | 650.54 g/mol |
| Exact Mass | 649.09 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,5R)-4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@](=S)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(Cl)(Cl)[C@@H]1O |
| InChI | InChI=1S/C22H34Cl2N3O9PS2/c1-12(2)35-17(30)13(3)26-37(38,33-9-10-39-19(31)21(4,5)6)34-11-14-16(29)22(23,24)18(36-14)27-8-7-15(28)25-20(27)32/h7-8,12-14,16,18,29H,9-11H2,1-6H3,(H,26,38)(H,25,28,32)/t13-,14-,16-,18-,37+/m1/s1 |
| InChIKey | VVRMVIIMHAYACC-OXVDMMMISA-N |
| XLogP | 2.46 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|