C22H34ClFN3O10PS — CID 123754513
propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 123754513) has the molecular formula C22H34ClFN3O10PS and a molecular weight of 618.02 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123754513 |
| Molecular Formula | C22H34ClFN3O10PS |
| Molecular Weight | 618.02 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCCSC(=O)C(C)(C)C)OCC1OC(n2ccc(=O)[nH]c2=O)C(F)(Cl)C1O |
| InChI | InChI=1S/C22H34ClFN3O10PS/c1-12(2)36-17(30)13(3)26-38(33,34-9-10-39-19(31)21(4,5)6)35-11-14-16(29)22(23,24)18(37-14)27-8-7-15(28)25-20(27)32/h7-8,12-14,16,18,29H,9-11H2,1-6H3,(H,26,33)(H,25,28,32) |
| InChIKey | IFHGKOPMMINYHN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.02 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|