C23H38Cl2N3O8PS2 — CID 123658472
propan-2-yl 2-[[[4,4-dichloro-3-hydroxy-5-(5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 123658472) has the molecular formula C23H38Cl2N3O8PS2 and a molecular weight of 650.58 g/mol. Its IUPAC name is propan-2-yl 2-[[[4,4-dichloro-3-hydroxy-5-(5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4,4-dichloro-3-hydroxy-5-(5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 123658472 |
| Molecular Formula | C23H38Cl2N3O8PS2 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | propan-2-yl 2-[[[4,4-dichloro-3-hydroxy-5-(5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC1=CN(C2OC(COP(=S)(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C)C(O)C2(Cl)Cl)CNC1=O |
| InChI | InChI=1S/C23H38Cl2N3O8PS2/c1-13(2)35-19(31)15(4)27-37(38,33-8-9-39-21(32)22(5,6)7)34-11-16-17(29)23(24,25)20(36-16)28-10-14(3)18(30)26-12-28/h10,13,15-17,20,29H,8-9,11-12H2,1-7H3,(H,26,30)(H,27,38) |
| InChIKey | CDYMZJQGRIWKLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|