C22H34Cl2N3O8PS2 — CID 123697803
propan-2-yl 2-[[[4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 123697803) has the molecular formula C22H34Cl2N3O8PS2 and a molecular weight of 634.54 g/mol. Its IUPAC name is propan-2-yl 2-[[[4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 123697803 |
| Molecular Formula | C22H34Cl2N3O8PS2 |
| Molecular Weight | 634.54 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | propan-2-yl 2-[[[4,4-dichloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=S)(OCCSC(=O)C(C)(C)C)OCC1CC(Cl)(Cl)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C22H34Cl2N3O8PS2/c1-13(2)34-17(29)14(3)26-36(37,32-9-10-38-19(30)21(4,5)6)33-12-15-11-22(23,24)18(35-15)27-8-7-16(28)25-20(27)31/h7-8,13-15,18H,9-12H2,1-6H3,(H,26,37)(H,25,28,31) |
| InChIKey | CICHTAAKWQWKTE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|