C22H35ClN3O9PS — CID 144853972
propan-2-yl (2R)-2-[[[(2S,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 144853972) has the molecular formula C22H35ClN3O9PS and a molecular weight of 584.03 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2S,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2S,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144853972 |
| Molecular Formula | C22H35ClN3O9PS |
| Molecular Weight | 584.03 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2S,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OCCSC(=O)C(C)(C)C)OC[C@@H]1C[C@H](Cl)[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C22H35ClN3O9PS/c1-13(2)34-19(28)14(3)25-36(31,32-9-10-37-20(29)22(4,5)6)33-12-15-11-16(23)18(35-15)26-8-7-17(27)24-21(26)30/h7-8,13-16,18H,9-12H2,1-6H3,(H,25,31)(H,24,27,30)/t14-,15+,16+,18-,36-/m1/s1 |
| InChIKey | CCFBFNHPJQRMRI-TWCQIYTASA-N |
| XLogP | 2.81 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|