C23H39ClN3O9PS — CID 144853883
propan-2-yl 2-[[[4-chloro-5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 144853883) has the molecular formula C23H39ClN3O9PS and a molecular weight of 600.07 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144853883 |
| Molecular Formula | C23H39ClN3O9PS |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCCSC(=O)C(C)(C)C)OCC1CC(Cl)C(N(C)/C=C\C(=O)NC=O)O1 |
| InChI | InChI=1S/C23H39ClN3O9PS/c1-15(2)35-21(30)16(3)26-37(32,33-10-11-38-22(31)23(4,5)6)34-13-17-12-18(24)20(36-17)27(7)9-8-19(29)25-14-28/h8-9,14-18,20H,10-13H2,1-7H3,(H,26,32)(H,25,28,29)/b9-8- |
| InChIKey | SQOPHCDSEINDES-HJWRWDBZSA-N |
| XLogP | 2.80 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|