C19H32N3O8PS2 — CID 139380122
propan-2-yl 2-[[[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]thiolan-2-yl]methoxy-(2-formylsulfanylethoxy)phosphoryl]amino]propanoate (PubChem CID 139380122) has the molecular formula C19H32N3O8PS2 and a molecular weight of 525.59 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]thiolan-2-yl]methoxy-(2-formylsulfanylethoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]thiolan-2-yl]methoxy-(2-formylsulfanylethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139380122 |
| Molecular Formula | C19H32N3O8PS2 |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | propan-2-yl 2-[[[5-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]thiolan-2-yl]methoxy-(2-formylsulfanylethoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)N[P@](=O)(OCCSC=O)OCC1CCC(N(C)/C=C\C(=O)NC=O)S1 |
| InChI | InChI=1S/C19H32N3O8PS2/c1-14(2)30-19(26)15(3)21-31(27,28-9-10-32-13-24)29-11-16-5-6-18(33-16)22(4)8-7-17(25)20-12-23/h7-8,12-16,18H,5-6,9-11H2,1-4H3,(H,21,27)(H,20,23,25)/b8-7-/t15?,16?,18?,31-/m0/s1 |
| InChIKey | RSNCKBQJXONONH-AXXYHNOXSA-N |
| XLogP | 1.92 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|