C24H45FN3O9PS — CID 144853907
(Z)-3-(dimethylamino)-N-formyl-2-methylprop-2-enamide;propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(3-fluoro-2-methoxypropoxy)phosphoryl]amino]propanoate (PubChem CID 144853907) has the molecular formula C24H45FN3O9PS and a molecular weight of 601.68 g/mol. Its IUPAC name is (Z)-3-(dimethylamino)-N-formyl-2-methylprop-2-enamide;propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(3-fluoro-2-methoxypropoxy)phosphoryl]amino]propanoate.
| Compound Name | (Z)-3-(dimethylamino)-N-formyl-2-methylprop-2-enamide;propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(3-fluoro-2-methoxypropoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144853907 |
| Molecular Formula | C24H45FN3O9PS |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (Z)-3-(dimethylamino)-N-formyl-2-methylprop-2-enamide;propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(3-fluoro-2-methoxypropoxy)phosphoryl]amino]propanoate |
| SMILES | C/C(=C/N(C)C)C(=O)NC=O.COC(CF)COP(=O)(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33FNO7PS.C7H12N2O2/c1-12(2)26-15(20)13(3)19-27(22,25-11-14(10-18)23-7)24-8-9-28-16(21)17(4,5)6;1-6(4-9(2)3)7(11)8-5-10/h12-14H,8-11H2,1-7H3,(H,19,22);4-5H,1-3H3,(H,8,10,11)/b;6-4- |
| InChIKey | LZGYBVSORKNYEZ-QQLTZMNSSA-N |
| XLogP | 3.07 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|