C23H36ClN6O8PS — CID 118126704
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 118126704) has the molecular formula C23H36ClN6O8PS and a molecular weight of 623.07 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118126704 |
| Molecular Formula | C23H36ClN6O8PS |
| Molecular Weight | 623.07 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C23H36ClN6O8PS/c1-12(2)37-21(32)13(3)29-39(34,35-7-8-40-22(33)23(4,5)6)36-9-14-17(31)15(24)20(38-14)30-11-28-16-18(25)26-10-27-19(16)30/h10-15,17,20,31H,7-9H2,1-6H3,(H,29,34)(H2,25,26,27)/t13?,14-,15-,17-,20-,39?/m1/s1 |
| InChIKey | IVTZIARXXPLUJZ-DIPZMRDUSA-N |
| XLogP | 2.65 |
| TPSA | 190.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|