C25H41N6O8PS — CID 123536288
propan-2-yl 2-[[2-[5-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]ethoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]amino]propanoate (PubChem CID 123536288) has the molecular formula C25H41N6O8PS and a molecular weight of 616.68 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[5-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]ethoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[2-[5-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]ethoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123536288 |
| Molecular Formula | C25H41N6O8PS |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | propan-2-yl 2-[[2-[5-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]ethoxy-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCCSC(=O)C(C)(C)CO)OCCC1CC(C)C(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C25H41N6O8PS/c1-15(2)38-23(33)17(4)30-40(35,37-9-10-41-24(34)25(5,6)12-32)36-8-7-18-11-16(3)22(39-18)31-14-29-19-20(26)27-13-28-21(19)31/h13-18,22,32H,7-12H2,1-6H3,(H,30,35)(H2,26,27,28) |
| InChIKey | UAKGGQUPZGCFSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 190.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|