C22H35Cl2N4O9PS — CID 118126264
propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 118126264) has the molecular formula C22H35Cl2N4O9PS and a molecular weight of 633.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118126264 |
| Molecular Formula | C22H35Cl2N4O9PS |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(Cl)(Cl)[C@@H]1O |
| InChI | InChI=1S/C22H35Cl2N4O9PS/c1-12(2)36-17(30)13(3)27-38(33,34-9-10-39-19(31)21(4,5)6)35-11-14-16(29)22(23,24)18(37-14)28-8-7-15(25)26-20(28)32/h7-8,12-14,16,18,29H,9-11H2,1-6H3,(H,27,33)(H2,25,26,32)/t13-,14+,16+,18+,38-/m0/s1 |
| InChIKey | LCEOKFJFACAGAC-RUZUIZHRSA-N |
| XLogP | 2.63 |
| TPSA | 181.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|