C23H39N4O9PS — CID 123710978
propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 123710978) has the molecular formula C23H39N4O9PS and a molecular weight of 578.63 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123710978 |
| Molecular Formula | C23H39N4O9PS |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-methoxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | COC1(COP(=O)(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C)CCC(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C23H39N4O9PS/c1-15(2)35-19(28)16(3)26-37(31,33-12-13-38-20(29)22(4,5)6)34-14-23(32-7)10-8-18(36-23)27-11-9-17(24)25-21(27)30/h9,11,15-16,18H,8,10,12-14H2,1-7H3,(H,26,31)(H2,24,25,30) |
| InChIKey | NWJKZQSPHRUZJQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 170.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|