C22H37N4O7PS — CID 144948929
propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate (PubChem CID 144948929) has the molecular formula C22H37N4O7PS and a molecular weight of 532.60 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144948929 |
| Molecular Formula | C22H37N4O7PS |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(OCCSC(=O)C(C)(C)C)OCC1CCC(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C22H37N4O7PS/c1-14(2)32-19(27)15(3)25-34(30-11-12-35-20(28)22(4,5)6)31-13-16-7-8-18(33-16)26-10-9-17(23)24-21(26)29/h9-10,14-16,18,25H,7-8,11-13H2,1-6H3,(H2,23,24,29) |
| InChIKey | PHNIREPRIJSXRR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|