C20H32N3O10P — CID 144948788
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]amino]propanoate (PubChem CID 144948788) has the molecular formula C20H32N3O10P and a molecular weight of 505.46 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144948788 |
| Molecular Formula | C20H32N3O10P |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphanyl]amino]propanoate |
| SMILES | CC(C)OC(=O)OCOP(NC(C)C(=O)OC(C)C)OCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C20H32N3O10P/c1-12(2)31-18(25)14(5)22-34(30-11-28-20(27)32-13(3)4)29-10-15-6-7-17(33-15)23-9-8-16(24)21-19(23)26/h8-9,12-15,17,22H,6-7,10-11H2,1-5H3,(H,21,24,26) |
| InChIKey | NLRAAWVJAFUXLX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|