C9H11N2O5P — CID 70849208
1-[(2R,5S)-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70849208) has the molecular formula C9H11N2O5P and a molecular weight of 258.17 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70849208 |
| Molecular Formula | C9H11N2O5P |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-[(2R,5S)-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=POC[C@@H]1CC[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H11N2O5P/c12-7-3-4-11(9(13)10-7)8-2-1-6(16-8)5-15-17-14/h3-4,6,8H,1-2,5H2,(H,10,12,13)/t6-,8+/m0/s1 |
| InChIKey | YGGZHJUWXMXTBJ-POYBYMJQSA-N |
| XLogP | 0.44 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|