C12H18N2O5 — CID 178082508
2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetaldehyde;methoxymethane (PubChem CID 178082508) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetaldehyde;methoxymethane.
| Compound Name | 2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetaldehyde;methoxymethane |
|---|---|
| PubChem CID | 178082508 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]acetaldehyde;methoxymethane |
| SMILES | COC.O=CCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H12N2O4.C2H6O/c13-6-4-7-1-2-9(16-7)12-5-3-8(14)11-10(12)15;1-3-2/h3,5-7,9H,1-2,4H2,(H,11,14,15);1-2H3 |
| InChIKey | JMAWPJJLIPATDR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|