C19H26N4O7 — CID 70261386
1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70261386) has the molecular formula C19H26N4O7 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70261386 |
| Molecular Formula | C19H26N4O7 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](C)O2)c(=O)[nH]c1=O.O=c1ccn([C@H]2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N2O3.C9H12N2O4/c1-6-5-12(10(14)11-9(6)13)8-4-3-7(2)15-8;12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14/h5,7-8H,3-4H2,1-2H3,(H,11,13,14);3-4,6,8,12H,1-2,5H2,(H,10,13,14)/t7-,8-;6-,8+/m10/s1 |
| InChIKey | UDTSHIMXPYRYML-QCNBXOQKSA-N |
| XLogP | -0.25 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |