C10H14N2O5 — CID 169201537
1-[5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione (PubChem CID 169201537) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione.
| Compound Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169201537 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione |
| SMILES | COc1cn(C2CCC(CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O5/c1-16-7-4-12(10(15)11-9(7)14)8-3-2-6(5-13)17-8/h4,6,8,13H,2-3,5H2,1H3,(H,11,14,15) |
| InChIKey | JZILTFNDOXBMFA-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |