C11H16N2O5 — CID 139418563
1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione (PubChem CID 139418563) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione.
| Compound Name | 1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139418563 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-[5-(2-hydroxyethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione |
| SMILES | COc1cn(C2CCC(CCO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O5/c1-17-8-6-13(11(16)12-10(8)15)9-3-2-7(18-9)4-5-14/h6-7,9,14H,2-5H2,1H3,(H,12,15,16) |
| InChIKey | CAWCNGCPLDQRAO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |