C10H13FN2O3 — CID 142167597
1-(5-ethyloxolan-2-yl)-5-fluoropyrimidine-2,4-dione (PubChem CID 142167597) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 1-(5-ethyloxolan-2-yl)-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(5-ethyloxolan-2-yl)-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142167597 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(5-ethyloxolan-2-yl)-5-fluoropyrimidine-2,4-dione |
| SMILES | CCC1CCC(n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H13FN2O3/c1-2-6-3-4-8(16-6)13-5-7(11)9(14)12-10(13)15/h5-6,8H,2-4H2,1H3,(H,12,14,15) |
| InChIKey | KQCJEDROPXPLOV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |