C10H16N2O5S — CID 177038919
1-[5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;sulfanol (PubChem CID 177038919) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;sulfanol.
| Compound Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;sulfanol |
|---|---|
| PubChem CID | 177038919 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-[5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione;sulfanol |
| SMILES | Cc1cn(C2CCC(CO)O2)c(=O)[nH]c1=O.OS |
| InChI | InChI=1S/C10H14N2O4.H2OS/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8;1-2/h4,7-8,13H,2-3,5H2,1H3,(H,11,14,15);1-2H |
| InChIKey | BPSSBNBRVOMKIP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|