C13H18N2O4 — CID 174347825
1-[7-(hydroxymethyl)-5-methylideneoxepan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174347825) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[7-(hydroxymethyl)-5-methylideneoxepan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[7-(hydroxymethyl)-5-methylideneoxepan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174347825 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[7-(hydroxymethyl)-5-methylideneoxepan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=C1CCC(n2cc(C)c(=O)[nH]c2=O)OC(CO)C1 |
| InChI | InChI=1S/C13H18N2O4/c1-8-3-4-11(19-10(5-8)7-16)15-6-9(2)12(17)14-13(15)18/h6,10-11,16H,1,3-5,7H2,2H3,(H,14,17,18) |
| InChIKey | UDTDOSBVOINMIX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|