C11H18N2O5 — CID 178082493
1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol (PubChem CID 178082493) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol.
| Compound Name | 1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol |
|---|---|
| PubChem CID | 178082493 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol |
| SMILES | CO.O=c1ccn(C2CCC(CCO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N2O4.CH4O/c13-6-4-7-1-2-9(16-7)12-5-3-8(14)11-10(12)15;1-2/h3,5,7,9,13H,1-2,4,6H2,(H,11,14,15);2H,1H3 |
| InChIKey | XOFJKWIIMQGPKR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |