C13H22N2O7P+ — CID 172580649
[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-diethoxy-hydroxyphosphanium (PubChem CID 172580649) has the molecular formula C13H22N2O7P+ and a molecular weight of 349.30 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-diethoxy-hydroxyphosphanium.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-diethoxy-hydroxyphosphanium |
|---|---|
| PubChem CID | 172580649 |
| Molecular Formula | C13H22N2O7P+ |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-diethoxy-hydroxyphosphanium |
| SMILES | CCO[P+](O)(OCC)OCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C13H21N2O7P/c1-3-19-23(18,20-4-2)21-9-10-5-6-12(22-10)15-8-7-11(16)14-13(15)17/h7-8,10,12,18H,3-6,9H2,1-2H3/p+1 |
| InChIKey | BCDAAZBNITUOAM-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|