C11H18N2O10P2 — CID 123726760
[2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethoxy-hydroxyphosphoryl] methyl hydrogen phosphate (PubChem CID 123726760) has the molecular formula C11H18N2O10P2 and a molecular weight of 400.22 g/mol. Its IUPAC name is [2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethoxy-hydroxyphosphoryl] methyl hydrogen phosphate.
| Compound Name | [2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethoxy-hydroxyphosphoryl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 123726760 |
| Molecular Formula | C11H18N2O10P2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethoxy-hydroxyphosphoryl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OP(=O)(O)OCCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C11H18N2O10P2/c1-20-24(16,17)23-25(18,19)21-7-5-8-2-3-10(22-8)13-6-4-9(14)12-11(13)15/h4,6,8,10H,2-3,5,7H2,1H3,(H,16,17)(H,18,19)(H,12,14,15) |
| InChIKey | OAQWLHAVLIBALP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|