C16H20N2O8 — CID 5274013
4-O-ethyl 1-O-methyl (Z)-2-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-enedioate (PubChem CID 5274013) has the molecular formula C16H20N2O8 and a molecular weight of 368.34 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (Z)-2-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-enedioate.
| Compound Name | 4-O-ethyl 1-O-methyl (Z)-2-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-enedioate |
|---|---|
| PubChem CID | 5274013 |
| Molecular Formula | C16H20N2O8 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (Z)-2-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OC)c1cn([C@H]2CC[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20N2O8/c1-3-25-13(20)6-10(15(22)24-2)11-7-18(16(23)17-14(11)21)12-5-4-9(8-19)26-12/h6-7,9,12,19H,3-5,8H2,1-2H3,(H,17,21,23)/b10-6-/t9-,12+/m0/s1 |
| InChIKey | CHXNGTYHVRIAGD-QGWPWEQESA-N |
| XLogP | -0.67 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|