C10H19N2O13P3 — CID 22823627
diphosphono hydrogen phosphate;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22823627) has the molecular formula C10H19N2O13P3 and a molecular weight of 468.19 g/mol. Its IUPAC name is diphosphono hydrogen phosphate;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | diphosphono hydrogen phosphate;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22823627 |
| Molecular Formula | C10H19N2O13P3 |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | diphosphono hydrogen phosphate;5-methyl-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](C)O2)c(=O)[nH]c1=O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H14N2O3.H5O10P3/c1-6-5-12(10(14)11-9(6)13)8-4-3-7(2)15-8;1-11(2,3)9-13(7,8)10-12(4,5)6/h5,7-8H,3-4H2,1-2H3,(H,11,13,14);(H,7,8)(H2,1,2,3)(H2,4,5,6)/t7-,8-;/m1./s1 |
| InChIKey | FYUOTCIMBCHACX-SCLLHFNJSA-N |
| XLogP | -0.15 |
| TPSA | 234.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|